Urolitiini B (1139-83-9) Valmistajan tehdas

Urolitiini B

Marraskuussa 9, 2020

Urolithin BSpecifications

Nimi: Urolitiini B
Kemiallinen nimi: 3-hydroksi-6H-dibentso [b, d] pyran-6-oni
CAS: +1139 83 9 XNUMX
Kemiallinen kaava: C13H8O3
Molekyylipaino: X
Väri:  Valkoinen jauhe
InChi-avain: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES-koodi: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Toiminto: Urolitiini B voi parantaa mitokondrioiden ja lihasten toimintaa.

Urolitiini B voi parantaa lihasvoimaa ja kestävyyttä ikääntymisen aikana.

Sovellus: Urolitiini B on suolen mikrobien metaboliitti ellagitannissa ja sillä on voimakkaita antioksidantti- ja hapettumisenestoaineita riippuen määritysjärjestelmästä ja olosuhteista. Urolitiini B voi myös osoittaa estrogeenistä ja / tai antiestrogeenistä aktiivisuutta.
Liukoisuus: Liukenee helposti N, N-dimetyyliformamidiin ja dimetyylimetyleeniin. Sulfoni, liukenee heikosti metanoliin, etanoliin ja etyyliasetaattiin
Tallennustila: Hygroskooppinen, -20 ° C Pakastin, Inertiivisessä ilmakehässä
Toimitusehto: Toimitetaan ympäristön lämpötilassa vaarattomana kemiallisena aineena. Tämä tuote on tarpeeksi vakaa muutaman viikon ajan tavallisen merenkulun ja Tullissa käytetyn ajan kuluessa.